potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid

C6H11KO5 — CID 173006474

IUPACpotassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid
SMILESCC(O)C(=O)OC(C)C(=O)O.[H-].[K+]
InChIInChI=1S/C6H10O5.K.H/c1-3(7)6(10)11-4(2)5(8)9;;/h3-4,7H,1-2H3,(H,8,9);;/q;+1;-1
InChIKeyBLHFZERUYLFKMU-UHFFFAOYSA-N
MW202.25 g/mol
LogP-3.50
Rot. Bonds3

About potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid

potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid (PubChem CID 173006474) has the molecular formula C6H11KO5 and a molecular weight of 202.25 g/mol. Its IUPAC name is potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid.

Molecular Properties

Compound Namepotassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid
PubChem CID173006474
Molecular FormulaC6H11KO5
Molecular Weight202.25 g/mol
Exact Mass202.02
IUPAC Namepotassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid
SMILESCC(O)C(=O)OC(C)C(=O)O.[H-].[K+]
InChIInChI=1S/C6H10O5.K.H/c1-3(7)6(10)11-4(2)5(8)9;;/h3-4,7H,1-2H3,(H,8,9);;/q;+1;-1
InChIKeyBLHFZERUYLFKMU-UHFFFAOYSA-N
XLogP-3.50
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.25
LogP ≤ 5-3.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid?
The IUPAC name of potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid (CID 173006474) is potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid.
What is the SMILES notation for potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid?
The canonical SMILES for potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid is CC(O)C(=O)OC(C)C(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid?
The InChIKey is BLHFZERUYLFKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5.K.H/c1-3(7)6(10)11-4(2)5(8)9;;/h3-4,7H,1-2H3,(H,8,9);;/q;+1;-1.
What are the key properties of potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid?
potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid has a molecular weight of 202.25 g/mol, XLogP of -3.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-(2-hydroxypropanoyloxy)propanoic acid is sourced from PubChem (CID 173006474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).