About [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate
[(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate (PubChem CID 171574297) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate |
| PubChem CID | 171574297 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate |
| SMILES | CC(C)[C@@H](C)OC(=O)[C@@H](C)O |
| InChI | InChI=1S/C8H16O3/c1-5(2)7(4)11-8(10)6(3)9/h5-7,9H,1-4H3/t6-,7-/m1/s1 |
| InChIKey | IGBMWTKQGKLBOF-RNFRBKRXSA-N |
| XLogP | 0.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate?
The IUPAC name of [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate (CID 171574297) is [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate.
What is the SMILES notation for [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate?
The canonical SMILES for [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate is CC(C)[C@@H](C)OC(=O)[C@@H](C)O.
What is the InChIKey of [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate?
The InChIKey is IGBMWTKQGKLBOF-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H16O3/c1-5(2)7(4)11-8(10)6(3)9/h5-7,9H,1-4H3/t6-,7-/m1/s1.
What are the key properties of [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate?
[(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate has a molecular weight of 160.21 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3-methylbutan-2-yl] (2R)-2-hydroxypropanoate is sourced from PubChem (CID 171574297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).