About [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate
[(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate (PubChem CID 167060953) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate |
| PubChem CID | 167060953 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate |
| SMILES | C[C@H](CO)OC(=O)[C@H](C)O |
| InChI | InChI=1S/C6H12O4/c1-4(3-7)10-6(9)5(2)8/h4-5,7-8H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | GYJYICVTDAAWHC-UHNVWZDZSA-N |
| XLogP | -0.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate?
The IUPAC name of [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate (CID 167060953) is [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate.
What is the SMILES notation for [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate?
The canonical SMILES for [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate is C[C@H](CO)OC(=O)[C@H](C)O.
What is the InChIKey of [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate?
The InChIKey is GYJYICVTDAAWHC-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H12O4/c1-4(3-7)10-6(9)5(2)8/h4-5,7-8H,3H2,1-2H3/t4-,5+/m1/s1.
What are the key properties of [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate?
[(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate has a molecular weight of 148.16 g/mol, XLogP of -0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-hydroxypropan-2-yl] (2S)-2-hydroxypropanoate is sourced from PubChem (CID 167060953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).