About decan-2-yl 2-hydroxypropanoate
decan-2-yl 2-hydroxypropanoate (PubChem CID 118918104) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is decan-2-yl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | decan-2-yl 2-hydroxypropanoate |
| PubChem CID | 118918104 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | decan-2-yl 2-hydroxypropanoate |
| SMILES | CCCCCCCCC(C)OC(=O)C(C)O |
| InChI | InChI=1S/C13H26O3/c1-4-5-6-7-8-9-10-11(2)16-13(15)12(3)14/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | RSXVQABDGDHTFZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-2-yl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-2-yl 2-hydroxypropanoate?
The IUPAC name of decan-2-yl 2-hydroxypropanoate (CID 118918104) is decan-2-yl 2-hydroxypropanoate.
What is the SMILES notation for decan-2-yl 2-hydroxypropanoate?
The canonical SMILES for decan-2-yl 2-hydroxypropanoate is CCCCCCCCC(C)OC(=O)C(C)O.
What is the InChIKey of decan-2-yl 2-hydroxypropanoate?
The InChIKey is RSXVQABDGDHTFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-4-5-6-7-8-9-10-11(2)16-13(15)12(3)14/h11-12,14H,4-10H2,1-3H3.
What are the key properties of decan-2-yl 2-hydroxypropanoate?
decan-2-yl 2-hydroxypropanoate has a molecular weight of 230.35 g/mol, XLogP of 3.05, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decan-2-yl 2-hydroxypropanoate is sourced from PubChem (CID 118918104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).