About octan-2-yl 2-bromo-3-oxobutanoate
octan-2-yl 2-bromo-3-oxobutanoate (PubChem CID 87346714) has the molecular formula C12H21BrO3
and a molecular weight of 293.20 g/mol. Its IUPAC name is octan-2-yl 2-bromo-3-oxobutanoate.
Molecular Properties
| Compound Name | octan-2-yl 2-bromo-3-oxobutanoate |
| PubChem CID | 87346714 |
| Molecular Formula | C12H21BrO3 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | octan-2-yl 2-bromo-3-oxobutanoate |
| SMILES | CCCCCCC(C)OC(=O)C(Br)C(C)=O |
| InChI | InChI=1S/C12H21BrO3/c1-4-5-6-7-8-9(2)16-12(15)11(13)10(3)14/h9,11H,4-8H2,1-3H3 |
| InChIKey | VRAOLSZYHSGPPO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 2-bromo-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 2-bromo-3-oxobutanoate?
The IUPAC name of octan-2-yl 2-bromo-3-oxobutanoate (CID 87346714) is octan-2-yl 2-bromo-3-oxobutanoate.
What is the SMILES notation for octan-2-yl 2-bromo-3-oxobutanoate?
The canonical SMILES for octan-2-yl 2-bromo-3-oxobutanoate is CCCCCCC(C)OC(=O)C(Br)C(C)=O.
What is the InChIKey of octan-2-yl 2-bromo-3-oxobutanoate?
The InChIKey is VRAOLSZYHSGPPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21BrO3/c1-4-5-6-7-8-9(2)16-12(15)11(13)10(3)14/h9,11H,4-8H2,1-3H3.
What are the key properties of octan-2-yl 2-bromo-3-oxobutanoate?
octan-2-yl 2-bromo-3-oxobutanoate has a molecular weight of 293.20 g/mol, XLogP of 3.24, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 2-bromo-3-oxobutanoate is sourced from PubChem (CID 87346714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).