About nonan-2-yl carbamate
nonan-2-yl carbamate (PubChem CID 19093303) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is nonan-2-yl carbamate.
Molecular Properties
| Compound Name | nonan-2-yl carbamate |
| PubChem CID | 19093303 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | nonan-2-yl carbamate |
| SMILES | CCCCCCCC(C)OC(N)=O |
| InChI | InChI=1S/C10H21NO2/c1-3-4-5-6-7-8-9(2)13-10(11)12/h9H,3-8H2,1-2H3,(H2,11,12) |
| InChIKey | OGOWFECIBJQSRR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-2-yl carbamate?
The IUPAC name of nonan-2-yl carbamate (CID 19093303) is nonan-2-yl carbamate.
What is the SMILES notation for nonan-2-yl carbamate?
The canonical SMILES for nonan-2-yl carbamate is CCCCCCCC(C)OC(N)=O.
What is the InChIKey of nonan-2-yl carbamate?
The InChIKey is OGOWFECIBJQSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-3-4-5-6-7-8-9(2)13-10(11)12/h9H,3-8H2,1-2H3,(H2,11,12).
What are the key properties of nonan-2-yl carbamate?
nonan-2-yl carbamate has a molecular weight of 187.28 g/mol, XLogP of 2.83, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-2-yl carbamate is sourced from PubChem (CID 19093303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).