About pentadecan-2-yl 2-bromoacetate
pentadecan-2-yl 2-bromoacetate (PubChem CID 536336) has the molecular formula C17H33BrO2
and a molecular weight of 349.35 g/mol. Its IUPAC name is pentadecan-2-yl 2-bromoacetate.
Molecular Properties
| Compound Name | pentadecan-2-yl 2-bromoacetate |
| PubChem CID | 536336 |
| Molecular Formula | C17H33BrO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | pentadecan-2-yl 2-bromoacetate |
| SMILES | CCCCCCCCCCCCCC(C)OC(=O)CBr |
| InChI | InChI=1S/C17H33BrO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(2)20-17(19)15-18/h16H,3-15H2,1-2H3 |
| InChIKey | YWIHESIZRKNLLM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze pentadecan-2-yl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecan-2-yl 2-bromoacetate?
The IUPAC name of pentadecan-2-yl 2-bromoacetate (CID 536336) is pentadecan-2-yl 2-bromoacetate.
What is the SMILES notation for pentadecan-2-yl 2-bromoacetate?
The canonical SMILES for pentadecan-2-yl 2-bromoacetate is CCCCCCCCCCCCCC(C)OC(=O)CBr.
What is the InChIKey of pentadecan-2-yl 2-bromoacetate?
The InChIKey is YWIHESIZRKNLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33BrO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(2)20-17(19)15-18/h16H,3-15H2,1-2H3.
What are the key properties of pentadecan-2-yl 2-bromoacetate?
pentadecan-2-yl 2-bromoacetate has a molecular weight of 349.35 g/mol, XLogP of 6.01, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecan-2-yl 2-bromoacetate is sourced from PubChem (CID 536336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).