About 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate
1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate (PubChem CID 3023842) has the molecular formula C5H9BrO4
and a molecular weight of 213.03 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate |
| PubChem CID | 3023842 |
| Molecular Formula | C5H9BrO4 |
| Molecular Weight | 213.03 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate |
| SMILES | CC(CO)OC(=O)C(O)Br |
| InChI | InChI=1S/C5H9BrO4/c1-3(2-7)10-5(9)4(6)8/h3-4,7-8H,2H2,1H3 |
| InChIKey | SMOOROHNJPGMPL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.03 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate?
The IUPAC name of 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate (CID 3023842) is 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate.
What is the SMILES notation for 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate?
The canonical SMILES for 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate is CC(CO)OC(=O)C(O)Br.
What is the InChIKey of 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate?
The InChIKey is SMOOROHNJPGMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BrO4/c1-3(2-7)10-5(9)4(6)8/h3-4,7-8H,2H2,1H3.
What are the key properties of 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate?
1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate has a molecular weight of 213.03 g/mol, XLogP of -0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-yl 2-bromo-2-hydroxyacetate is sourced from PubChem (CID 3023842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).