About 1-hydroxypropan-2-yl 6-hydroxyhexanoate
1-hydroxypropan-2-yl 6-hydroxyhexanoate (PubChem CID 58519851) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl 6-hydroxyhexanoate.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-yl 6-hydroxyhexanoate |
| PubChem CID | 58519851 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-hydroxypropan-2-yl 6-hydroxyhexanoate |
| SMILES | CC(CO)OC(=O)CCCCCO |
| InChI | InChI=1S/C9H18O4/c1-8(7-11)13-9(12)5-3-2-4-6-10/h8,10-11H,2-7H2,1H3 |
| InChIKey | JGGHVRJLUGFGBQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropan-2-yl 6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-yl 6-hydroxyhexanoate?
The IUPAC name of 1-hydroxypropan-2-yl 6-hydroxyhexanoate (CID 58519851) is 1-hydroxypropan-2-yl 6-hydroxyhexanoate.
What is the SMILES notation for 1-hydroxypropan-2-yl 6-hydroxyhexanoate?
The canonical SMILES for 1-hydroxypropan-2-yl 6-hydroxyhexanoate is CC(CO)OC(=O)CCCCCO.
What is the InChIKey of 1-hydroxypropan-2-yl 6-hydroxyhexanoate?
The InChIKey is JGGHVRJLUGFGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-8(7-11)13-9(12)5-3-2-4-6-10/h8,10-11H,2-7H2,1H3.
What are the key properties of 1-hydroxypropan-2-yl 6-hydroxyhexanoate?
1-hydroxypropan-2-yl 6-hydroxyhexanoate has a molecular weight of 190.24 g/mol, XLogP of 0.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-yl 6-hydroxyhexanoate is sourced from PubChem (CID 58519851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).