About 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate
1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate (PubChem CID 101288809) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate |
| PubChem CID | 101288809 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate |
| SMILES | CC(CO)OC(=O)CCCCCCCCCCC1OC1C |
| InChI | InChI=1S/C17H32O4/c1-14(13-18)20-17(19)12-10-8-6-4-3-5-7-9-11-16-15(2)21-16/h14-16,18H,3-13H2,1-2H3 |
| InChIKey | ADCFRMYYFGJCIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate?
The IUPAC name of 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate (CID 101288809) is 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate.
What is the SMILES notation for 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate?
The canonical SMILES for 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate is CC(CO)OC(=O)CCCCCCCCCCC1OC1C.
What is the InChIKey of 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate?
The InChIKey is ADCFRMYYFGJCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4/c1-14(13-18)20-17(19)12-10-8-6-4-3-5-7-9-11-16-15(2)21-16/h14-16,18H,3-13H2,1-2H3.
What are the key properties of 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate?
1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate has a molecular weight of 300.44 g/mol, XLogP of 3.60, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-yl 11-(3-methyloxiran-2-yl)undecanoate is sourced from PubChem (CID 101288809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).