10-(3-methyloxiran-2-yl)decanoic acid

C13H24O3 — CID 141449209

IUPAC10-(3-methyloxiran-2-yl)decanoic acid
SMILESCC1OC1CCCCCCCCCC(=O)O
InChIInChI=1S/C13H24O3/c1-11-12(16-11)9-7-5-3-2-4-6-8-10-13(14)15/h11-12H,2-10H2,1H3,(H,14,15)
InChIKeyNSWNYSNINDTDCC-UHFFFAOYSA-N
MW228.33 g/mol
LogP3.37
Rot. Bonds10

About 10-(3-methyloxiran-2-yl)decanoic acid

10-(3-methyloxiran-2-yl)decanoic acid (PubChem CID 141449209) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 10-(3-methyloxiran-2-yl)decanoic acid.

Molecular Properties

Compound Name10-(3-methyloxiran-2-yl)decanoic acid
PubChem CID141449209
Molecular FormulaC13H24O3
Molecular Weight228.33 g/mol
Exact Mass228.17
IUPAC Name10-(3-methyloxiran-2-yl)decanoic acid
SMILESCC1OC1CCCCCCCCCC(=O)O
InChIInChI=1S/C13H24O3/c1-11-12(16-11)9-7-5-3-2-4-6-8-10-13(14)15/h11-12H,2-10H2,1H3,(H,14,15)
InChIKeyNSWNYSNINDTDCC-UHFFFAOYSA-N
XLogP3.37
TPSA49.83 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.33
LogP ≤ 53.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze 10-(3-methyloxiran-2-yl)decanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-(3-methyloxiran-2-yl)decanoic acid?
The IUPAC name of 10-(3-methyloxiran-2-yl)decanoic acid (CID 141449209) is 10-(3-methyloxiran-2-yl)decanoic acid.
What is the SMILES notation for 10-(3-methyloxiran-2-yl)decanoic acid?
The canonical SMILES for 10-(3-methyloxiran-2-yl)decanoic acid is CC1OC1CCCCCCCCCC(=O)O.
What is the InChIKey of 10-(3-methyloxiran-2-yl)decanoic acid?
The InChIKey is NSWNYSNINDTDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-11-12(16-11)9-7-5-3-2-4-6-8-10-13(14)15/h11-12H,2-10H2,1H3,(H,14,15).
What are the key properties of 10-(3-methyloxiran-2-yl)decanoic acid?
10-(3-methyloxiran-2-yl)decanoic acid has a molecular weight of 228.33 g/mol, XLogP of 3.37, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-methyloxiran-2-yl)decanoic acid is sourced from PubChem (CID 141449209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).