About iron;bis(8-(3-octyloxiran-2-yl)octanoic acid)
iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) (PubChem CID 153323059) has the molecular formula C36H68FeO6
and a molecular weight of 652.78 g/mol. Its IUPAC name is iron;bis(8-(3-octyloxiran-2-yl)octanoic acid).
Molecular Properties
| Compound Name | iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) |
| PubChem CID | 153323059 |
| Molecular Formula | C36H68FeO6 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.44 |
| IUPAC Name | iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) |
| SMILES | CCCCCCCCC1OC1CCCCCCCC(=O)O.CCCCCCCCC1OC1CCCCCCCC(=O)O.[Fe] |
| InChI | InChI=1S/2C18H34O3.Fe/c2*1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20;/h2*16-17H,2-15H2,1H3,(H,19,20); |
| InChIKey | OHSHQQFRWLTGAG-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;bis(8-(3-octyloxiran-2-yl)octanoic acid)?
The IUPAC name of iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) (CID 153323059) is iron;bis(8-(3-octyloxiran-2-yl)octanoic acid).
What is the SMILES notation for iron;bis(8-(3-octyloxiran-2-yl)octanoic acid)?
The canonical SMILES for iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) is CCCCCCCCC1OC1CCCCCCCC(=O)O.CCCCCCCCC1OC1CCCCCCCC(=O)O.[Fe].
What is the InChIKey of iron;bis(8-(3-octyloxiran-2-yl)octanoic acid)?
The InChIKey is OHSHQQFRWLTGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H34O3.Fe/c2*1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20;/h2*16-17H,2-15H2,1H3,(H,19,20);.
What are the key properties of iron;bis(8-(3-octyloxiran-2-yl)octanoic acid)?
iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) has a molecular weight of 652.78 g/mol, XLogP of 10.64, 30 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron;bis(8-(3-octyloxiran-2-yl)octanoic acid) is sourced from PubChem (CID 153323059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).