C26H46O6 — CID 54531231
2,2-dibutyl-6-[3-[2-[3-(5-carboxypentyl)oxiran-2-yl]ethyl]oxiran-2-yl]hexanoic acid (PubChem CID 54531231) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is 2,2-dibutyl-6-[3-[2-[3-(5-carboxypentyl)oxiran-2-yl]ethyl]oxiran-2-yl]hexanoic acid.
| Compound Name | 2,2-dibutyl-6-[3-[2-[3-(5-carboxypentyl)oxiran-2-yl]ethyl]oxiran-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 54531231 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | 2,2-dibutyl-6-[3-[2-[3-(5-carboxypentyl)oxiran-2-yl]ethyl]oxiran-2-yl]hexanoic acid |
| SMILES | CCCCC(CCCC)(CCCCC1OC1CCC1OC1CCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H46O6/c1-3-5-17-26(25(29)30,18-6-4-2)19-11-10-13-21-23(32-21)16-15-22-20(31-22)12-8-7-9-14-24(27)28/h20-23H,3-19H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | YWRQSJFXWFEXDG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|