C18H32O5 — CID 87164539
8-[(3R)-3-(7-carboxyheptyl)oxiran-2-yl]octanoic acid (PubChem CID 87164539) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is 8-[(3R)-3-(7-carboxyheptyl)oxiran-2-yl]octanoic acid.
| Compound Name | 8-[(3R)-3-(7-carboxyheptyl)oxiran-2-yl]octanoic acid |
|---|---|
| PubChem CID | 87164539 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 8-[(3R)-3-(7-carboxyheptyl)oxiran-2-yl]octanoic acid |
| SMILES | O=C(O)CCCCCCCC1O[C@@H]1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O5/c19-17(20)13-9-5-1-3-7-11-15-16(23-15)12-8-4-2-6-10-14-18(21)22/h15-16H,1-14H2,(H,19,20)(H,21,22)/t15-,16?/m1/s1 |
| InChIKey | HBJUPPWOEYNGBO-AAFJCEBUSA-N |
| XLogP | 4.38 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|