C20H36O3 — CID 35026353
(Z)-13-[(2R,3S)-3-pentyloxiran-2-yl]tridec-5-enoic acid (PubChem CID 35026353) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (Z)-13-[(2R,3S)-3-pentyloxiran-2-yl]tridec-5-enoic acid.
| Compound Name | (Z)-13-[(2R,3S)-3-pentyloxiran-2-yl]tridec-5-enoic acid |
|---|---|
| PubChem CID | 35026353 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (Z)-13-[(2R,3S)-3-pentyloxiran-2-yl]tridec-5-enoic acid |
| SMILES | CCCCC[C@@H]1O[C@@H]1CCCCCCC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H36O3/c1-2-3-12-15-18-19(23-18)16-13-10-8-6-4-5-7-9-11-14-17-20(21)22/h7,9,18-19H,2-6,8,10-17H2,1H3,(H,21,22)/b9-7-/t18-,19+/m0/s1 |
| InChIKey | KZTLOTWHEAHQAZ-CUZNAYPQSA-N |
| XLogP | 5.88 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|