About decanedioic acid;dimethyltin
decanedioic acid;dimethyltin (PubChem CID 174830885) has the molecular formula C12H24O4Sn
and a molecular weight of 351.03 g/mol. Its IUPAC name is decanedioic acid;dimethyltin.
Molecular Properties
| Compound Name | decanedioic acid;dimethyltin |
| PubChem CID | 174830885 |
| Molecular Formula | C12H24O4Sn |
| Molecular Weight | 351.03 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | decanedioic acid;dimethyltin |
| SMILES | C[Sn]C.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.2CH3.Sn/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;;/h1-8H2,(H,11,12)(H,13,14);2*1H3; |
| InChIKey | SHPUELCUDMJJNI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.03 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanedioic acid;dimethyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanedioic acid;dimethyltin?
The IUPAC name of decanedioic acid;dimethyltin (CID 174830885) is decanedioic acid;dimethyltin.
What is the SMILES notation for decanedioic acid;dimethyltin?
The canonical SMILES for decanedioic acid;dimethyltin is C[Sn]C.O=C(O)CCCCCCCCC(=O)O.
What is the InChIKey of decanedioic acid;dimethyltin?
The InChIKey is SHPUELCUDMJJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.2CH3.Sn/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;;/h1-8H2,(H,11,12)(H,13,14);2*1H3;.
What are the key properties of decanedioic acid;dimethyltin?
decanedioic acid;dimethyltin has a molecular weight of 351.03 g/mol, XLogP of 3.06, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanedioic acid;dimethyltin is sourced from PubChem (CID 174830885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).