About 4-hydroxybutan-2-yl octadecanoate
4-hydroxybutan-2-yl octadecanoate (PubChem CID 71324433) has the molecular formula C22H44O3
and a molecular weight of 356.59 g/mol. Its IUPAC name is 4-hydroxybutan-2-yl octadecanoate.
Molecular Properties
| Compound Name | 4-hydroxybutan-2-yl octadecanoate |
| PubChem CID | 71324433 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 4-hydroxybutan-2-yl octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC(C)CCO |
| InChI | InChI=1S/C22H44O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(24)25-21(2)19-20-23/h21,23H,3-20H2,1-2H3 |
| InChIKey | NTGPOQUYQAPDHT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutan-2-yl octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutan-2-yl octadecanoate?
The IUPAC name of 4-hydroxybutan-2-yl octadecanoate (CID 71324433) is 4-hydroxybutan-2-yl octadecanoate.
What is the SMILES notation for 4-hydroxybutan-2-yl octadecanoate?
The canonical SMILES for 4-hydroxybutan-2-yl octadecanoate is CCCCCCCCCCCCCCCCCC(=O)OC(C)CCO.
What is the InChIKey of 4-hydroxybutan-2-yl octadecanoate?
The InChIKey is NTGPOQUYQAPDHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(24)25-21(2)19-20-23/h21,23H,3-20H2,1-2H3.
What are the key properties of 4-hydroxybutan-2-yl octadecanoate?
4-hydroxybutan-2-yl octadecanoate has a molecular weight of 356.59 g/mol, XLogP of 6.56, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutan-2-yl octadecanoate is sourced from PubChem (CID 71324433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).