About 5-hydroxyhexan-2-yl decanoate
5-hydroxyhexan-2-yl decanoate (PubChem CID 170848666) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 5-hydroxyhexan-2-yl decanoate.
Molecular Properties
| Compound Name | 5-hydroxyhexan-2-yl decanoate |
| PubChem CID | 170848666 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 5-hydroxyhexan-2-yl decanoate |
| SMILES | CCCCCCCCCC(=O)OC(C)CCC(C)O |
| InChI | InChI=1S/C16H32O3/c1-4-5-6-7-8-9-10-11-16(18)19-15(3)13-12-14(2)17/h14-15,17H,4-13H2,1-3H3 |
| InChIKey | HCNHVPMIDWTDNY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyhexan-2-yl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyhexan-2-yl decanoate?
The IUPAC name of 5-hydroxyhexan-2-yl decanoate (CID 170848666) is 5-hydroxyhexan-2-yl decanoate.
What is the SMILES notation for 5-hydroxyhexan-2-yl decanoate?
The canonical SMILES for 5-hydroxyhexan-2-yl decanoate is CCCCCCCCCC(=O)OC(C)CCC(C)O.
What is the InChIKey of 5-hydroxyhexan-2-yl decanoate?
The InChIKey is HCNHVPMIDWTDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-4-5-6-7-8-9-10-11-16(18)19-15(3)13-12-14(2)17/h14-15,17H,4-13H2,1-3H3.
What are the key properties of 5-hydroxyhexan-2-yl decanoate?
5-hydroxyhexan-2-yl decanoate has a molecular weight of 272.43 g/mol, XLogP of 4.22, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyhexan-2-yl decanoate is sourced from PubChem (CID 170848666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).