About 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate
1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate (PubChem CID 157191539) has the molecular formula C10H22N2O6
and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate |
| PubChem CID | 157191539 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)CO.CNC(=O)OCC(C)O |
| InChI | InChI=1S/2C5H11NO3/c1-4(7)3-9-5(8)6-2;1-4(3-7)9-5(8)6-2/h2*4,7H,3H2,1-2H3,(H,6,8) |
| InChIKey | APTGRDOMPIRBQW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate?
The IUPAC name of 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate (CID 157191539) is 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate.
What is the SMILES notation for 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate?
The canonical SMILES for 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate is CNC(=O)OC(C)CO.CNC(=O)OCC(C)O.
What is the InChIKey of 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate?
The InChIKey is APTGRDOMPIRBQW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO3/c1-4(7)3-9-5(8)6-2;1-4(3-7)9-5(8)6-2/h2*4,7H,3H2,1-2H3,(H,6,8).
What are the key properties of 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate?
1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate has a molecular weight of 266.29 g/mol, XLogP of -0.55, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-yl N-methylcarbamate;2-hydroxypropyl N-methylcarbamate is sourced from PubChem (CID 157191539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).