C8H15O7P — CID 153444400
1-hydroxypropan-2-yl 1-phosphanyloxycarbonyloxypropan-2-yl carbonate (PubChem CID 153444400) has the molecular formula C8H15O7P and a molecular weight of 254.17 g/mol. Its IUPAC name is 1-hydroxypropan-2-yl 1-phosphanyloxycarbonyloxypropan-2-yl carbonate.
| Compound Name | 1-hydroxypropan-2-yl 1-phosphanyloxycarbonyloxypropan-2-yl carbonate |
|---|---|
| PubChem CID | 153444400 |
| Molecular Formula | C8H15O7P |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-hydroxypropan-2-yl 1-phosphanyloxycarbonyloxypropan-2-yl carbonate |
| SMILES | CC(CO)OC(=O)OC(C)COC(=O)OP |
| InChI | InChI=1S/C8H15O7P/c1-5(3-9)13-8(11)14-6(2)4-12-7(10)15-16/h5-6,9H,3-4,16H2,1-2H3 |
| InChIKey | BVHFJSKZKXILRT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|