C7H10F2O6 — CID 130266239
1-(fluoromethoxycarbonyloxy)propan-2-yl fluoromethyl carbonate (PubChem CID 130266239) has the molecular formula C7H10F2O6 and a molecular weight of 228.15 g/mol. Its IUPAC name is 1-(fluoromethoxycarbonyloxy)propan-2-yl fluoromethyl carbonate.
| Compound Name | 1-(fluoromethoxycarbonyloxy)propan-2-yl fluoromethyl carbonate |
|---|---|
| PubChem CID | 130266239 |
| Molecular Formula | C7H10F2O6 |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1-(fluoromethoxycarbonyloxy)propan-2-yl fluoromethyl carbonate |
| SMILES | CC(COC(=O)OCF)OC(=O)OCF |
| InChI | InChI=1S/C7H10F2O6/c1-5(15-7(11)14-4-9)2-12-6(10)13-3-8/h5H,2-4H2,1H3 |
| InChIKey | YVHULZKHCVVPAJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |