C7H14O7 — CID 174639053
bis(1-hydroperoxypropan-2-yl) carbonate (PubChem CID 174639053) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is bis(1-hydroperoxypropan-2-yl) carbonate.
| Compound Name | bis(1-hydroperoxypropan-2-yl) carbonate |
|---|---|
| PubChem CID | 174639053 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | bis(1-hydroperoxypropan-2-yl) carbonate |
| SMILES | CC(COO)OC(=O)OC(C)COO |
| InChI | InChI=1S/C7H14O7/c1-5(3-11-9)13-7(8)14-6(2)4-12-10/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | CJIDXMAUEHWMGO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|