About 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate
1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate (PubChem CID 88542811) has the molecular formula C18H30O12
and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate |
| PubChem CID | 88542811 |
| Molecular Formula | C18H30O12 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate |
| SMILES | COC(C)COC(=O)OC(C)COC(=O)CC(=O)OCC(C)OC(=O)OCC(C)O |
| InChI | InChI=1S/C18H30O12/c1-11(19)7-27-17(22)29-13(3)9-25-15(20)6-16(21)26-10-14(4)30-18(23)28-8-12(2)24-5/h11-14,19H,6-10H2,1-5H3 |
| InChIKey | DFTUPUBNWYATQH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate?
The IUPAC name of 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate (CID 88542811) is 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate.
What is the SMILES notation for 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate?
The canonical SMILES for 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate is COC(C)COC(=O)OC(C)COC(=O)CC(=O)OCC(C)OC(=O)OCC(C)O.
What is the InChIKey of 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate?
The InChIKey is DFTUPUBNWYATQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O12/c1-11(19)7-27-17(22)29-13(3)9-25-15(20)6-16(21)26-10-14(4)30-18(23)28-8-12(2)24-5/h11-14,19H,6-10H2,1-5H3.
What are the key properties of 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate?
1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate has a molecular weight of 438.43 g/mol, XLogP of 0.96, 13 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate is sourced from PubChem (CID 88542811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).