C18H30O12 — CID 88542811
1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate (PubChem CID 88542811) has the molecular formula C18H30O12 and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate.
| Compound Name | 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate |
|---|---|
| PubChem CID | 88542811 |
| Molecular Formula | C18H30O12 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-O-[2-(2-hydroxypropoxycarbonyloxy)propyl] 3-O-[2-(2-methoxypropoxycarbonyloxy)propyl] propanedioate |
| SMILES | COC(C)COC(=O)OC(C)COC(=O)CC(=O)OCC(C)OC(=O)OCC(C)O |
| InChI | InChI=1S/C18H30O12/c1-11(19)7-27-17(22)29-13(3)9-25-15(20)6-16(21)26-10-14(4)30-18(23)28-8-12(2)24-5/h11-14,19H,6-10H2,1-5H3 |
| InChIKey | DFTUPUBNWYATQH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|