C16H27BrO8 — CID 155655819
1-O-[1-(1-hydroxypropan-2-yloxycarbonyloxy)propan-2-yl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate (PubChem CID 155655819) has the molecular formula C16H27BrO8 and a molecular weight of 427.29 g/mol. Its IUPAC name is 1-O-[1-(1-hydroxypropan-2-yloxycarbonyloxy)propan-2-yl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[1-(1-hydroxypropan-2-yloxycarbonyloxy)propan-2-yl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 155655819 |
| Molecular Formula | C16H27BrO8 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-O-[1-(1-hydroxypropan-2-yloxycarbonyloxy)propan-2-yl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate |
| SMILES | COC(=O)C(C)(Br)CC(C)(C)C(=O)OC(C)COC(=O)OC(C)CO |
| InChI | InChI=1S/C16H27BrO8/c1-10(7-18)25-14(21)23-8-11(2)24-12(19)15(3,4)9-16(5,17)13(20)22-6/h10-11,18H,7-9H2,1-6H3 |
| InChIKey | YXXYZXWJZJYGDB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|