C8H8BrF7O2 — CID 155658087
methyl 2-bromo-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pentanoate (PubChem CID 155658087) has the molecular formula C8H8BrF7O2 and a molecular weight of 349.04 g/mol. Its IUPAC name is methyl 2-bromo-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pentanoate.
| Compound Name | methyl 2-bromo-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 155658087 |
| Molecular Formula | C8H8BrF7O2 |
| Molecular Weight | 349.04 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | methyl 2-bromo-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pentanoate |
| SMILES | COC(=O)C(C)(Br)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8BrF7O2/c1-5(9,4(17)18-2)3-6(10,7(11,12)13)8(14,15)16/h3H2,1-2H3 |
| InChIKey | BCYJMVXFWIBDAF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.04 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|