C5H8BrF2NO2 — CID 15939140
methyl (2R)-2-amino-3-bromo-3,3-difluoro-2-methylpropanoate (PubChem CID 15939140) has the molecular formula C5H8BrF2NO2 and a molecular weight of 232.02 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-bromo-3,3-difluoro-2-methylpropanoate.
| Compound Name | methyl (2R)-2-amino-3-bromo-3,3-difluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 15939140 |
| Molecular Formula | C5H8BrF2NO2 |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | methyl (2R)-2-amino-3-bromo-3,3-difluoro-2-methylpropanoate |
| SMILES | COC(=O)[C@@](C)(N)C(F)(F)Br |
| InChI | InChI=1S/C5H8BrF2NO2/c1-4(9,3(10)11-2)5(6,7)8/h9H2,1-2H3/t4-/m1/s1 |
| InChIKey | XMYPZAVFOSPDCA-SCSAIBSYSA-N |
| XLogP | 0.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|