C5H3ClF6O2 — CID 13024469
methyl 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 13024469) has the molecular formula C5H3ClF6O2 and a molecular weight of 244.52 g/mol. Its IUPAC name is methyl 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | methyl 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 13024469 |
| Molecular Formula | C5H3ClF6O2 |
| Molecular Weight | 244.52 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | methyl 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | COC(=O)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3ClF6O2/c1-14-2(13)3(6,4(7,8)9)5(10,11)12/h1H3 |
| InChIKey | SCFPEEUERPSNPO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|