C7H10F2O4 — CID 135382206
3,3-difluoro-2-methoxycarbonyl-2-methylbutanoic acid (PubChem CID 135382206) has the molecular formula C7H10F2O4 and a molecular weight of 196.15 g/mol. Its IUPAC name is 3,3-difluoro-2-methoxycarbonyl-2-methylbutanoic acid.
| Compound Name | 3,3-difluoro-2-methoxycarbonyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 135382206 |
| Molecular Formula | C7H10F2O4 |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 3,3-difluoro-2-methoxycarbonyl-2-methylbutanoic acid |
| SMILES | COC(=O)C(C)(C(=O)O)C(C)(F)F |
| InChI | InChI=1S/C7H10F2O4/c1-6(4(10)11,5(12)13-3)7(2,8)9/h1-3H3,(H,10,11) |
| InChIKey | RNTHHNROEONAIG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|