C8H11ClO4 — CID 173450863
4-chloro-2-methoxycarbonyl-2-methylpent-3-enoic acid (PubChem CID 173450863) has the molecular formula C8H11ClO4 and a molecular weight of 206.62 g/mol. Its IUPAC name is 4-chloro-2-methoxycarbonyl-2-methylpent-3-enoic acid.
| Compound Name | 4-chloro-2-methoxycarbonyl-2-methylpent-3-enoic acid |
|---|---|
| PubChem CID | 173450863 |
| Molecular Formula | C8H11ClO4 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 4-chloro-2-methoxycarbonyl-2-methylpent-3-enoic acid |
| SMILES | COC(=O)C(C)(C=C(C)Cl)C(=O)O |
| InChI | InChI=1S/C8H11ClO4/c1-5(9)4-8(2,6(10)11)7(12)13-3/h4H,1-3H3,(H,10,11) |
| InChIKey | DVSISOHXUFVUSA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|