C6H5F7O4 — CID 88741812
2,2,3,3,4,4-hexafluoro-5-methoxy-5-oxopentanoic acid;hydrofluoride (PubChem CID 88741812) has the molecular formula C6H5F7O4 and a molecular weight of 274.09 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-methoxy-5-oxopentanoic acid;hydrofluoride.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-methoxy-5-oxopentanoic acid;hydrofluoride |
|---|---|
| PubChem CID | 88741812 |
| Molecular Formula | C6H5F7O4 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-methoxy-5-oxopentanoic acid;hydrofluoride |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O.F |
| InChI | InChI=1S/C6H4F6O4.FH/c1-16-3(15)5(9,10)6(11,12)4(7,8)2(13)14;/h1H3,(H,13,14);1H |
| InChIKey | JRNSHQWQJSSMHC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|