C8H8F8O4 — CID 171417883
methyl 2,2,3,3,4,4,5,5-octafluoro-6-hydroxy-6-methoxyhexanoate (PubChem CID 171417883) has the molecular formula C8H8F8O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is methyl 2,2,3,3,4,4,5,5-octafluoro-6-hydroxy-6-methoxyhexanoate.
| Compound Name | methyl 2,2,3,3,4,4,5,5-octafluoro-6-hydroxy-6-methoxyhexanoate |
|---|---|
| PubChem CID | 171417883 |
| Molecular Formula | C8H8F8O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl 2,2,3,3,4,4,5,5-octafluoro-6-hydroxy-6-methoxyhexanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)OC |
| InChI | InChI=1S/C8H8F8O4/c1-19-3(17)5(9,10)7(13,14)8(15,16)6(11,12)4(18)20-2/h3,17H,1-2H3 |
| InChIKey | VZMMOJPYRYCBRG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|