C17H14F10O3 — CID 12696875
methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxo-7-(2,4,6-trimethylphenyl)heptanoate (PubChem CID 12696875) has the molecular formula C17H14F10O3 and a molecular weight of 456.28 g/mol. Its IUPAC name is methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxo-7-(2,4,6-trimethylphenyl)heptanoate.
| Compound Name | methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxo-7-(2,4,6-trimethylphenyl)heptanoate |
|---|---|
| PubChem CID | 12696875 |
| Molecular Formula | C17H14F10O3 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxo-7-(2,4,6-trimethylphenyl)heptanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H14F10O3/c1-7-5-8(2)10(9(3)6-7)11(28)13(18,19)15(22,23)17(26,27)16(24,25)14(20,21)12(29)30-4/h5-6H,1-4H3 |
| InChIKey | BRDALAGBSOKOEN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|