C14H20N3O3P — CID 174682632
methyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate (PubChem CID 174682632) has the molecular formula C14H20N3O3P and a molecular weight of 309.31 g/mol. Its IUPAC name is methyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate.
| Compound Name | methyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 174682632 |
| Molecular Formula | C14H20N3O3P |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate |
| SMILES | COC(=O)C(P)(N=C(N)N)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H20N3O3P/c1-7-5-8(2)10(9(3)6-7)11(18)14(21,12(19)20-4)17-13(15)16/h5-6H,21H2,1-4H3,(H4,15,16,17) |
| InChIKey | FDKOKZCAYUMHDB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|