C17H26N3O3P — CID 174680890
tert-butyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate (PubChem CID 174680890) has the molecular formula C17H26N3O3P and a molecular weight of 351.39 g/mol. Its IUPAC name is tert-butyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate.
| Compound Name | tert-butyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 174680890 |
| Molecular Formula | C17H26N3O3P |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 2-(diaminomethylideneamino)-3-oxo-2-phosphanyl-3-(2,4,6-trimethylphenyl)propanoate |
| SMILES | Cc1cc(C)c(C(=O)C(P)(N=C(N)N)C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H26N3O3P/c1-9-7-10(2)12(11(3)8-9)13(21)17(24,20-15(18)19)14(22)23-16(4,5)6/h7-8H,24H2,1-6H3,(H4,18,19,20) |
| InChIKey | CXGNVGCXGQVGFO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|