tert-butyl 2,3-diamino-5-methylbenzoate

C12H18N2O2 — CID 81443568

IUPACtert-butyl 2,3-diamino-5-methylbenzoate
SMILESCc1cc(N)c(N)c(C(=O)OC(C)(C)C)c1
InChIInChI=1S/C12H18N2O2/c1-7-5-8(10(14)9(13)6-7)11(15)16-12(2,3)4/h5-6H,13-14H2,1-4H3
InChIKeyUVLBXKQCHIRRAU-UHFFFAOYSA-N
MW222.29 g/mol
LogP2.11
Rot. Bonds1

About tert-butyl 2,3-diamino-5-methylbenzoate

tert-butyl 2,3-diamino-5-methylbenzoate (PubChem CID 81443568) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is tert-butyl 2,3-diamino-5-methylbenzoate.

Molecular Properties

Compound Nametert-butyl 2,3-diamino-5-methylbenzoate
PubChem CID81443568
Molecular FormulaC12H18N2O2
Molecular Weight222.29 g/mol
Exact Mass222.14
IUPAC Nametert-butyl 2,3-diamino-5-methylbenzoate
SMILESCc1cc(N)c(N)c(C(=O)OC(C)(C)C)c1
InChIInChI=1S/C12H18N2O2/c1-7-5-8(10(14)9(13)6-7)11(15)16-12(2,3)4/h5-6H,13-14H2,1-4H3
InChIKeyUVLBXKQCHIRRAU-UHFFFAOYSA-N
XLogP2.11
TPSA78.34 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.29
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze tert-butyl 2,3-diamino-5-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,3-diamino-5-methylbenzoate?
The IUPAC name of tert-butyl 2,3-diamino-5-methylbenzoate (CID 81443568) is tert-butyl 2,3-diamino-5-methylbenzoate.
What is the SMILES notation for tert-butyl 2,3-diamino-5-methylbenzoate?
The canonical SMILES for tert-butyl 2,3-diamino-5-methylbenzoate is Cc1cc(N)c(N)c(C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl 2,3-diamino-5-methylbenzoate?
The InChIKey is UVLBXKQCHIRRAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-7-5-8(10(14)9(13)6-7)11(15)16-12(2,3)4/h5-6H,13-14H2,1-4H3.
What are the key properties of tert-butyl 2,3-diamino-5-methylbenzoate?
tert-butyl 2,3-diamino-5-methylbenzoate has a molecular weight of 222.29 g/mol, XLogP of 2.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3-diamino-5-methylbenzoate is sourced from PubChem (CID 81443568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).