C13H18N2O5 — CID 71224690
2-O-tert-butyl 4-O-methyl 3-amino-6-methyl-1-oxidopyridin-1-ium-2,4-dicarboxylate (PubChem CID 71224690) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl 3-amino-6-methyl-1-oxidopyridin-1-ium-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-methyl 3-amino-6-methyl-1-oxidopyridin-1-ium-2,4-dicarboxylate |
|---|---|
| PubChem CID | 71224690 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl 3-amino-6-methyl-1-oxidopyridin-1-ium-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C)[n+]([O-])c(C(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C13H18N2O5/c1-7-6-8(11(16)19-5)9(14)10(15(7)18)12(17)20-13(2,3)4/h6H,14H2,1-5H3 |
| InChIKey | ZVRYCNUDFGNJQB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|