C14H18ClNO7S — CID 175246771
3-O-tert-butyl 1-O-methyl 4-amino-5-chlorosulfonyl-6-methoxybenzene-1,3-dicarboxylate (PubChem CID 175246771) has the molecular formula C14H18ClNO7S and a molecular weight of 379.82 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 4-amino-5-chlorosulfonyl-6-methoxybenzene-1,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 4-amino-5-chlorosulfonyl-6-methoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175246771 |
| Molecular Formula | C14H18ClNO7S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 4-amino-5-chlorosulfonyl-6-methoxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC(C)(C)C)c(N)c(S(=O)(=O)Cl)c1OC |
| InChI | InChI=1S/C14H18ClNO7S/c1-14(2,3)23-13(18)7-6-8(12(17)22-5)10(21-4)11(9(7)16)24(15,19)20/h6H,16H2,1-5H3 |
| InChIKey | QZHVUZABOKBXIG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|