C15H20O4 — CID 10849217
2-hydroperoxy-2-methyl-1-(2,4,6-trimethylphenyl)pentane-1,3-dione (PubChem CID 10849217) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-hydroperoxy-2-methyl-1-(2,4,6-trimethylphenyl)pentane-1,3-dione.
| Compound Name | 2-hydroperoxy-2-methyl-1-(2,4,6-trimethylphenyl)pentane-1,3-dione |
|---|---|
| PubChem CID | 10849217 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-hydroperoxy-2-methyl-1-(2,4,6-trimethylphenyl)pentane-1,3-dione |
| SMILES | CCC(=O)C(C)(OO)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H20O4/c1-6-12(16)15(5,19-18)14(17)13-10(3)7-9(2)8-11(13)4/h7-8,18H,6H2,1-5H3 |
| InChIKey | FUGCNNXXGMOUKV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|