About 1-fluoroethenyl 2,4,6-trimethylbenzoate
1-fluoroethenyl 2,4,6-trimethylbenzoate (PubChem CID 101453567) has the molecular formula C12H13FO2
and a molecular weight of 208.23 g/mol. Its IUPAC name is 1-fluoroethenyl 2,4,6-trimethylbenzoate.
Molecular Properties
| Compound Name | 1-fluoroethenyl 2,4,6-trimethylbenzoate |
| PubChem CID | 101453567 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-fluoroethenyl 2,4,6-trimethylbenzoate |
| SMILES | C=C(F)OC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H13FO2/c1-7-5-8(2)11(9(3)6-7)12(14)15-10(4)13/h5-6H,4H2,1-3H3 |
| InChIKey | NDOXHDUQPGAWRT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroethenyl 2,4,6-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethenyl 2,4,6-trimethylbenzoate?
The IUPAC name of 1-fluoroethenyl 2,4,6-trimethylbenzoate (CID 101453567) is 1-fluoroethenyl 2,4,6-trimethylbenzoate.
What is the SMILES notation for 1-fluoroethenyl 2,4,6-trimethylbenzoate?
The canonical SMILES for 1-fluoroethenyl 2,4,6-trimethylbenzoate is C=C(F)OC(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of 1-fluoroethenyl 2,4,6-trimethylbenzoate?
The InChIKey is NDOXHDUQPGAWRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO2/c1-7-5-8(2)11(9(3)6-7)12(14)15-10(4)13/h5-6H,4H2,1-3H3.
What are the key properties of 1-fluoroethenyl 2,4,6-trimethylbenzoate?
1-fluoroethenyl 2,4,6-trimethylbenzoate has a molecular weight of 208.23 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethenyl 2,4,6-trimethylbenzoate is sourced from PubChem (CID 101453567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).