C28H26O2P+ — CID 156789006
triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium (PubChem CID 156789006) has the molecular formula C28H26O2P+ and a molecular weight of 425.49 g/mol. Its IUPAC name is triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium.
| Compound Name | triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium |
|---|---|
| PubChem CID | 156789006 |
| Molecular Formula | C28H26O2P+ |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium |
| SMILES | Cc1cc(C)c(C(=O)O[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H26O2P/c1-21-19-22(2)27(23(3)20-21)28(29)30-31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-20H,1-3H3/q+1 |
| InChIKey | HKAARBIGZAYPQZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|