About triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium
triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium (PubChem CID 156789006) has the molecular formula C28H26O2P+
and a molecular weight of 425.49 g/mol. Its IUPAC name is triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium.
Molecular Properties
| Compound Name | triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium |
| PubChem CID | 156789006 |
| Molecular Formula | C28H26O2P+ |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium |
| SMILES | Cc1cc(C)c(C(=O)O[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H26O2P/c1-21-19-22(2)27(23(3)20-21)28(29)30-31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-20H,1-3H3/q+1 |
| InChIKey | HKAARBIGZAYPQZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium?
The IUPAC name of triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium (CID 156789006) is triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium.
What is the SMILES notation for triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium?
The canonical SMILES for triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium is Cc1cc(C)c(C(=O)O[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1.
What is the InChIKey of triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium?
The InChIKey is HKAARBIGZAYPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O2P/c1-21-19-22(2)27(23(3)20-21)28(29)30-31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-20H,1-3H3/q+1.
What are the key properties of triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium?
triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium has a molecular weight of 425.49 g/mol, XLogP of 5.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl-(2,4,6-trimethylbenzoyl)oxyphosphanium is sourced from PubChem (CID 156789006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).