C24H24O — CID 3112974
3,3-diphenyl-1-(2,4,6-trimethylphenyl)propan-1-one (PubChem CID 3112974) has the molecular formula C24H24O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3,3-diphenyl-1-(2,4,6-trimethylphenyl)propan-1-one.
| Compound Name | 3,3-diphenyl-1-(2,4,6-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 3112974 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3,3-diphenyl-1-(2,4,6-trimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C(=O)CC(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H24O/c1-17-14-18(2)24(19(3)15-17)23(25)16-22(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-15,22H,16H2,1-3H3 |
| InChIKey | MXAKUQXCLQZBLP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |