C18H18O4 — CID 70040052
2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethylbenzoic acid (PubChem CID 70040052) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethylbenzoic acid.
| Compound Name | 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 70040052 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)C(CO)c2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H18O4/c1-11-8-12(2)16(14(9-11)18(21)22)17(20)15(10-19)13-6-4-3-5-7-13/h3-9,15,19H,10H2,1-2H3,(H,21,22) |
| InChIKey | CACVMHNCVHVTAJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |