2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid

C18H18O6 — CID 70042456

IUPAC2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid
SMILESCOc1cc(OC)c(C(=O)C(CO)c2ccccc2)c(C(=O)O)c1
InChIInChI=1S/C18H18O6/c1-23-12-8-13(18(21)22)16(15(9-12)24-2)17(20)14(10-19)11-6-4-3-5-7-11/h3-9,14,19H,10H2,1-2H3,(H,21,22)
InChIKeyCEFAVGCBQWGIET-UHFFFAOYSA-N
MW330.34 g/mol
LogP2.36
Rot. Bonds7

About 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid

2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid (PubChem CID 70042456) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid.

Molecular Properties

Compound Name2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid
PubChem CID70042456
Molecular FormulaC18H18O6
Molecular Weight330.34 g/mol
Exact Mass330.11
IUPAC Name2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid
SMILESCOc1cc(OC)c(C(=O)C(CO)c2ccccc2)c(C(=O)O)c1
InChIInChI=1S/C18H18O6/c1-23-12-8-13(18(21)22)16(15(9-12)24-2)17(20)14(10-19)11-6-4-3-5-7-11/h3-9,14,19H,10H2,1-2H3,(H,21,22)
InChIKeyCEFAVGCBQWGIET-UHFFFAOYSA-N
XLogP2.36
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.34
LogP ≤ 52.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid?
The IUPAC name of 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid (CID 70042456) is 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid.
What is the SMILES notation for 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid?
The canonical SMILES for 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid is COc1cc(OC)c(C(=O)C(CO)c2ccccc2)c(C(=O)O)c1.
What is the InChIKey of 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid?
The InChIKey is CEFAVGCBQWGIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O6/c1-23-12-8-13(18(21)22)16(15(9-12)24-2)17(20)14(10-19)11-6-4-3-5-7-11/h3-9,14,19H,10H2,1-2H3,(H,21,22).
What are the key properties of 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid?
2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid has a molecular weight of 330.34 g/mol, XLogP of 2.36, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-2-phenylpropanoyl)-3,5-dimethoxybenzoic acid is sourced from PubChem (CID 70042456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).