C18H19O2P — CID 70014464
1-(2,6-dimethylphenyl)-2-phenyl-4-phosphorosobutan-1-one (PubChem CID 70014464) has the molecular formula C18H19O2P and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-phenyl-4-phosphorosobutan-1-one.
| Compound Name | 1-(2,6-dimethylphenyl)-2-phenyl-4-phosphorosobutan-1-one |
|---|---|
| PubChem CID | 70014464 |
| Molecular Formula | C18H19O2P |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-phenyl-4-phosphorosobutan-1-one |
| SMILES | Cc1cccc(C)c1C(=O)C(CCP=O)c1ccccc1 |
| InChI | InChI=1S/C18H19O2P/c1-13-7-6-8-14(2)17(13)18(19)16(11-12-21-20)15-9-4-3-5-10-15/h3-10,16H,11-12H2,1-2H3 |
| InChIKey | UZBCDWNCJSGFPX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|