C16H15FO — CID 174928566
4-fluoro-1,2-diphenylbutan-1-one (PubChem CID 174928566) has the molecular formula C16H15FO and a molecular weight of 242.29 g/mol. Its IUPAC name is 4-fluoro-1,2-diphenylbutan-1-one.
| Compound Name | 4-fluoro-1,2-diphenylbutan-1-one |
|---|---|
| PubChem CID | 174928566 |
| Molecular Formula | C16H15FO |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-fluoro-1,2-diphenylbutan-1-one |
| SMILES | O=C(c1ccccc1)C(CCF)c1ccccc1 |
| InChI | InChI=1S/C16H15FO/c17-12-11-15(13-7-3-1-4-8-13)16(18)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | SQNVDBJNGVORDV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |