C17H20NO+ — CID 6947215
dimethyl-[(2S)-3-oxo-2,3-diphenylpropyl]azanium (PubChem CID 6947215) has the molecular formula C17H20NO+ and a molecular weight of 254.35 g/mol. Its IUPAC name is dimethyl-[(2S)-3-oxo-2,3-diphenylpropyl]azanium.
| Compound Name | dimethyl-[(2S)-3-oxo-2,3-diphenylpropyl]azanium |
|---|---|
| PubChem CID | 6947215 |
| Molecular Formula | C17H20NO+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | dimethyl-[(2S)-3-oxo-2,3-diphenylpropyl]azanium |
| SMILES | C[NH+](C)C[C@@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-18(2)13-16(14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | GJUPMIOTRBVKSA-MRXNPFEDSA-O |
| XLogP | 1.80 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |