C23H24NO+ — CID 2093668
dimethyl-[(2R)-1-oxo-1,3,3-triphenylpropan-2-yl]azanium (PubChem CID 2093668) has the molecular formula C23H24NO+ and a molecular weight of 330.45 g/mol. Its IUPAC name is dimethyl-[(2R)-1-oxo-1,3,3-triphenylpropan-2-yl]azanium.
| Compound Name | dimethyl-[(2R)-1-oxo-1,3,3-triphenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 2093668 |
| Molecular Formula | C23H24NO+ |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | dimethyl-[(2R)-1-oxo-1,3,3-triphenylpropan-2-yl]azanium |
| SMILES | C[NH+](C)[C@@H](C(=O)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO/c1-24(2)22(23(25)20-16-10-5-11-17-20)21(18-12-6-3-7-13-18)19-14-8-4-9-15-19/h3-17,21-22H,1-2H3/p+1/t22-/m1/s1 |
| InChIKey | SZXDHSMXKRLDLO-JOCHJYFZSA-O |
| XLogP | 3.21 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |