C19H22O — CID 78133328
4,4-dimethyl-1,2-diphenylpentan-1-one (PubChem CID 78133328) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 4,4-dimethyl-1,2-diphenylpentan-1-one.
| Compound Name | 4,4-dimethyl-1,2-diphenylpentan-1-one |
|---|---|
| PubChem CID | 78133328 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4,4-dimethyl-1,2-diphenylpentan-1-one |
| SMILES | CC(C)(C)CC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22O/c1-19(2,3)14-17(15-10-6-4-7-11-15)18(20)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3 |
| InChIKey | URXPJZVYBKRBFG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |