C17H25NO4 — CID 70072802
2-[(3-carboxy-3-phenylpropyl)amino]-4,4-dimethylpentanoic acid (PubChem CID 70072802) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[(3-carboxy-3-phenylpropyl)amino]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[(3-carboxy-3-phenylpropyl)amino]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 70072802 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[(3-carboxy-3-phenylpropyl)amino]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(NCCC(C(=O)O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-17(2,3)11-14(16(21)22)18-10-9-13(15(19)20)12-7-5-4-6-8-12/h4-8,13-14,18H,9-11H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | AFGPWZLTFQIERM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |