1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride

C19H21ClNO- — CID 53347376

IUPAC1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride
SMILESO=C(c1ccccc1)C(CN1CCCC1)c1ccccc1.[Cl-]
InChIInChI=1S/C19H21NO.ClH/c21-19(17-11-5-2-6-12-17)18(15-20-13-7-8-14-20)16-9-3-1-4-10-16;/h1-6,9-12,18H,7-8,13-15H2;1H/p-1
InChIKeyIHKNYPYJYZUMMA-UHFFFAOYSA-M
MW314.84 g/mol
LogP0.75
Rot. Bonds5

About 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride

1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride (PubChem CID 53347376) has the molecular formula C19H21ClNO- and a molecular weight of 314.84 g/mol. Its IUPAC name is 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride.

Molecular Properties

Compound Name1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride
PubChem CID53347376
Molecular FormulaC19H21ClNO-
Molecular Weight314.84 g/mol
Exact Mass314.13
IUPAC Name1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride
SMILESO=C(c1ccccc1)C(CN1CCCC1)c1ccccc1.[Cl-]
InChIInChI=1S/C19H21NO.ClH/c21-19(17-11-5-2-6-12-17)18(15-20-13-7-8-14-20)16-9-3-1-4-10-16;/h1-6,9-12,18H,7-8,13-15H2;1H/p-1
InChIKeyIHKNYPYJYZUMMA-UHFFFAOYSA-M
XLogP0.75
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.84
LogP ≤ 50.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride?
The IUPAC name of 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride (CID 53347376) is 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride.
What is the SMILES notation for 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride?
The canonical SMILES for 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride is O=C(c1ccccc1)C(CN1CCCC1)c1ccccc1.[Cl-].
What is the InChIKey of 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride?
The InChIKey is IHKNYPYJYZUMMA-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H21NO.ClH/c21-19(17-11-5-2-6-12-17)18(15-20-13-7-8-14-20)16-9-3-1-4-10-16;/h1-6,9-12,18H,7-8,13-15H2;1H/p-1.
What are the key properties of 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride?
1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride has a molecular weight of 314.84 g/mol, XLogP of 0.75, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenyl-3-pyrrolidin-1-ylpropan-1-one chloride is sourced from PubChem (CID 53347376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).